C30H31F2N7O — CID 118537869
5-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-piperidin-4-yloxybenzonitrile (PubChem CID 118537869) has the molecular formula C30H31F2N7O and a molecular weight of 543.62 g/mol. Its IUPAC name is 5-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-piperidin-4-yloxybenzonitrile.
| Compound Name | 5-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-piperidin-4-yloxybenzonitrile |
|---|---|
| PubChem CID | 118537869 |
| Molecular Formula | C30H31F2N7O |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 5-[6-[4-[4-(2,2-difluoroethyl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-piperidin-4-yloxybenzonitrile |
| SMILES | N#Cc1cc(-c2ncnc3[nH]c(-c4ccc(N5CCN(CC(F)F)CC5)cc4)cc23)ccc1OC1CCNCC1 |
| InChI | InChI=1S/C30H31F2N7O/c31-28(32)18-38-11-13-39(14-12-38)23-4-1-20(2-5-23)26-16-25-29(35-19-36-30(25)37-26)21-3-6-27(22(15-21)17-33)40-24-7-9-34-10-8-24/h1-6,15-16,19,24,28,34H,7-14,18H2,(H,35,36,37) |
| InChIKey | SRDCCSNBQDUTBH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|