About 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one
5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one (PubChem CID 118538086) has the molecular formula C11H11FN2O
and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one |
| PubChem CID | 118538086 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1c(-c2ccccc2F)[nH]n(C)c1=O |
| InChI | InChI=1S/C11H11FN2O/c1-7-10(13-14(2)11(7)15)8-5-3-4-6-9(8)12/h3-6,13H,1-2H3 |
| InChIKey | BTIAGNGPHAOHNH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one?
The IUPAC name of 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one (CID 118538086) is 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one?
The canonical SMILES for 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one is Cc1c(-c2ccccc2F)[nH]n(C)c1=O.
What is the InChIKey of 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one?
The InChIKey is BTIAGNGPHAOHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O/c1-7-10(13-14(2)11(7)15)8-5-3-4-6-9(8)12/h3-6,13H,1-2H3.
What are the key properties of 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one?
5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one has a molecular weight of 206.22 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-2,4-dimethyl-1H-pyrazol-3-one is sourced from PubChem (CID 118538086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).