C12H14N2OS — CID 118538341
2,4-dimethyl-5-(4-methylsulfanylphenyl)-1H-pyrazol-3-one (PubChem CID 118538341) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-(4-methylsulfanylphenyl)-1H-pyrazol-3-one.
| Compound Name | 2,4-dimethyl-5-(4-methylsulfanylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 118538341 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2,4-dimethyl-5-(4-methylsulfanylphenyl)-1H-pyrazol-3-one |
| SMILES | CSc1ccc(-c2[nH]n(C)c(=O)c2C)cc1 |
| InChI | InChI=1S/C12H14N2OS/c1-8-11(13-14(2)12(8)15)9-4-6-10(16-3)7-5-9/h4-7,13H,1-3H3 |
| InChIKey | VCVASQKPKMZXJM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |