About 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one
4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one (PubChem CID 118538344) has the molecular formula C14H19N3O4S
and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one.
Molecular Properties
| Compound Name | 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one |
| PubChem CID | 118538344 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one |
| SMILES | CC(C)S(=O)(=O)c1ccc(C2=NN(C)C(=O)C2(C)NO)cc1 |
| InChI | InChI=1S/C14H19N3O4S/c1-9(2)22(20,21)11-7-5-10(6-8-11)12-14(3,16-19)13(18)17(4)15-12/h5-9,16,19H,1-4H3 |
| InChIKey | NUZGPEXTHZCJKZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one?
The IUPAC name of 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one (CID 118538344) is 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one.
What is the SMILES notation for 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one?
The canonical SMILES for 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one is CC(C)S(=O)(=O)c1ccc(C2=NN(C)C(=O)C2(C)NO)cc1.
What is the InChIKey of 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one?
The InChIKey is NUZGPEXTHZCJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4S/c1-9(2)22(20,21)11-7-5-10(6-8-11)12-14(3,16-19)13(18)17(4)15-12/h5-9,16,19H,1-4H3.
What are the key properties of 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one?
4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one has a molecular weight of 325.39 g/mol, XLogP of 0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxyamino)-2,4-dimethyl-5-(4-propan-2-ylsulfonylphenyl)pyrazol-3-one is sourced from PubChem (CID 118538344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).