About 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole
3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole (PubChem CID 118538374) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole |
| PubChem CID | 118538374 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole |
| SMILES | COc1c(-c2noc(-c3ccccc3)n2)c(C)nn1C |
| InChI | InChI=1S/C14H14N4O2/c1-9-11(14(19-3)18(2)16-9)12-15-13(20-17-12)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | KBNHIQXEKOLBOA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole?
The IUPAC name of 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole (CID 118538374) is 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole.
What is the SMILES notation for 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole?
The canonical SMILES for 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole is COc1c(-c2noc(-c3ccccc3)n2)c(C)nn1C.
What is the InChIKey of 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole?
The InChIKey is KBNHIQXEKOLBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-9-11(14(19-3)18(2)16-9)12-15-13(20-17-12)10-7-5-4-6-8-10/h4-8H,1-3H3.
What are the key properties of 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole?
3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole has a molecular weight of 270.29 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxy-1,3-dimethylpyrazol-4-yl)-5-phenyl-1,2,4-oxadiazole is sourced from PubChem (CID 118538374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).