C11H10N2O2S — CID 118538403
3-(4-methylsulfanylphenyl)-5-oxo-1,2-dihydropyrazole-4-carbaldehyde (PubChem CID 118538403) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(4-methylsulfanylphenyl)-5-oxo-1,2-dihydropyrazole-4-carbaldehyde.
| Compound Name | 3-(4-methylsulfanylphenyl)-5-oxo-1,2-dihydropyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118538403 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-(4-methylsulfanylphenyl)-5-oxo-1,2-dihydropyrazole-4-carbaldehyde |
| SMILES | CSc1ccc(-c2[nH][nH]c(=O)c2C=O)cc1 |
| InChI | InChI=1S/C11H10N2O2S/c1-16-8-4-2-7(3-5-8)10-9(6-14)11(15)13-12-10/h2-6H,1H3,(H2,12,13,15) |
| InChIKey | GBNBMOWNNPDOBT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|