C12H14N2O3S — CID 118538412
2,4-dimethyl-5-(4-methylsulfonylphenyl)-1H-pyrazol-3-one (PubChem CID 118538412) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-(4-methylsulfonylphenyl)-1H-pyrazol-3-one.
| Compound Name | 2,4-dimethyl-5-(4-methylsulfonylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 118538412 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2,4-dimethyl-5-(4-methylsulfonylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1c(-c2ccc(S(C)(=O)=O)cc2)[nH]n(C)c1=O |
| InChI | InChI=1S/C12H14N2O3S/c1-8-11(13-14(2)12(8)15)9-4-6-10(7-5-9)18(3,16)17/h4-7,13H,1-3H3 |
| InChIKey | IMFYYTYKWWYSEG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |