C23H21FN2O2 — CID 11853891
4-(3,3-dimethylbut-1-ynyl)-2-fluoro-N-isoquinolin-5-yl-3-methoxybenzamide (PubChem CID 11853891) has the molecular formula C23H21FN2O2 and a molecular weight of 376.43 g/mol. Its IUPAC name is 4-(3,3-dimethylbut-1-ynyl)-2-fluoro-N-isoquinolin-5-yl-3-methoxybenzamide.
| Compound Name | 4-(3,3-dimethylbut-1-ynyl)-2-fluoro-N-isoquinolin-5-yl-3-methoxybenzamide |
|---|---|
| PubChem CID | 11853891 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-(3,3-dimethylbut-1-ynyl)-2-fluoro-N-isoquinolin-5-yl-3-methoxybenzamide |
| SMILES | COc1c(C#CC(C)(C)C)ccc(C(=O)Nc2cccc3cnccc23)c1F |
| InChI | InChI=1S/C23H21FN2O2/c1-23(2,3)12-10-15-8-9-18(20(24)21(15)28-4)22(27)26-19-7-5-6-16-14-25-13-11-17(16)19/h5-9,11,13-14H,1-4H3,(H,26,27) |
| InChIKey | JSFFCQYNKLMMBD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|