C30H41N3O2 — CID 118539378
N-[(3R)-1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]pyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 118539378) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[(3R)-1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]pyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[(3R)-1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]pyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118539378 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-[(3R)-1-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]pyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N1CC[C@@H](NC(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C30H41N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29(34)33-24-22-28(26-33)32-30(35)27-20-19-23-31-25-27/h3-4,6-7,9-10,12-13,15-16,19-20,23,25,28H,2,5,8,11,14,17-18,21-22,24,26H2,1H3,(H,32,35)/b4-3-,7-6-,10-9-,13-12-,16-15-/t28-/m1/s1 |
| InChIKey | IGQGGPGGHUAGKA-PFKJUNFWSA-N |
| XLogP | 6.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|