C24H23ClN2O5S — CID 118540420
2-[(1S,3R)-3-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]cyclopentyl]isoindole-1,3-dione (PubChem CID 118540420) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]cyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,3R)-3-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]cyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118540420 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[(1S,3R)-3-[(2-tert-butyl-6-chloro-1,3-benzoxazol-7-yl)sulfonyl]cyclopentyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)c1nc2ccc(Cl)c(S(=O)(=O)[C@@H]3CC[C@H](N4C(=O)c5ccccc5C4=O)C3)c2o1 |
| InChI | InChI=1S/C24H23ClN2O5S/c1-24(2,3)23-26-18-11-10-17(25)20(19(18)32-23)33(30,31)14-9-8-13(12-14)27-21(28)15-6-4-5-7-16(15)22(27)29/h4-7,10-11,13-14H,8-9,12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | JFXSTYSGYDCRQZ-UONOGXRCSA-N |
| XLogP | 4.77 |
| TPSA | 97.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|