C19H24Cl2FN3O4S — CID 118540547
1-[(1S)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-3-(1-ethyl-4-fluoropiperidin-4-yl)sulfonyl-2-hydroxyphenyl]urea (PubChem CID 118540547) has the molecular formula C19H24Cl2FN3O4S and a molecular weight of 480.39 g/mol. Its IUPAC name is 1-[(1S)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-3-(1-ethyl-4-fluoropiperidin-4-yl)sulfonyl-2-hydroxyphenyl]urea.
| Compound Name | 1-[(1S)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-3-(1-ethyl-4-fluoropiperidin-4-yl)sulfonyl-2-hydroxyphenyl]urea |
|---|---|
| PubChem CID | 118540547 |
| Molecular Formula | C19H24Cl2FN3O4S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-[(1S)-2-chlorocyclopent-2-en-1-yl]-3-[4-chloro-3-(1-ethyl-4-fluoropiperidin-4-yl)sulfonyl-2-hydroxyphenyl]urea |
| SMILES | CCN1CCC(F)(S(=O)(=O)c2c(Cl)ccc(NC(=O)N[C@H]3CCC=C3Cl)c2O)CC1 |
| InChI | InChI=1S/C19H24Cl2FN3O4S/c1-2-25-10-8-19(22,9-11-25)30(28,29)17-13(21)6-7-15(16(17)26)24-18(27)23-14-5-3-4-12(14)20/h4,6-7,14,26H,2-3,5,8-11H2,1H3,(H2,23,24,27)/t14-/m0/s1 |
| InChIKey | ZGDLFWQIWYURFC-AWEZNQCLSA-N |
| XLogP | 4.01 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|