C35H34N6O3S2 — CID 118540849
3-cyano-4-[4-phenyl-2-[3-[(2-piperidin-4-ylethylamino)methyl]phenyl]phenoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 118540849) has the molecular formula C35H34N6O3S2 and a molecular weight of 650.83 g/mol. Its IUPAC name is 3-cyano-4-[4-phenyl-2-[3-[(2-piperidin-4-ylethylamino)methyl]phenyl]phenoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-cyano-4-[4-phenyl-2-[3-[(2-piperidin-4-ylethylamino)methyl]phenyl]phenoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118540849 |
| Molecular Formula | C35H34N6O3S2 |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | 3-cyano-4-[4-phenyl-2-[3-[(2-piperidin-4-ylethylamino)methyl]phenyl]phenoxy]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | N#Cc1cc(S(=O)(=O)Nc2ncns2)ccc1Oc1ccc(-c2ccccc2)cc1-c1cccc(CNCCC2CCNCC2)c1 |
| InChI | InChI=1S/C35H34N6O3S2/c36-22-30-20-31(46(42,43)41-35-39-24-40-45-35)10-12-33(30)44-34-11-9-28(27-6-2-1-3-7-27)21-32(34)29-8-4-5-26(19-29)23-38-18-15-25-13-16-37-17-14-25/h1-12,19-21,24-25,37-38H,13-18,23H2,(H,39,40,41) |
| InChIKey | DPLDQFWAZOESKQ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|