C25H33N3OS — CID 11854101
(4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(thiolan-3-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone (PubChem CID 11854101) has the molecular formula C25H33N3OS and a molecular weight of 423.63 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(thiolan-3-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(thiolan-3-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
|---|---|
| PubChem CID | 11854101 |
| Molecular Formula | C25H33N3OS |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(thiolan-3-yl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
| SMILES | C=CCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(C1CCSC1)CC2 |
| InChI | InChI=1S/C25H33N3OS/c1-3-10-28-23-5-4-19(25(29)26-11-6-18(2)7-12-26)15-21(23)22-16-27(13-8-24(22)28)20-9-14-30-17-20/h3-5,15,18,20H,1,6-14,16-17H2,2H3 |
| InChIKey | VFLISWQYADXVAI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|