C31H31Cl2F3N4O3 — CID 118541055
3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propylcarbamic acid (PubChem CID 118541055) has the molecular formula C31H31Cl2F3N4O3 and a molecular weight of 635.51 g/mol. Its IUPAC name is 3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propylcarbamic acid.
| Compound Name | 3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propylcarbamic acid |
|---|---|
| PubChem CID | 118541055 |
| Molecular Formula | C31H31Cl2F3N4O3 |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propylcarbamic acid |
| SMILES | O=C(O)NCCCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CN3CCN(Cc4c(Cl)cccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C31H31Cl2F3N4O3/c32-27-3-1-4-28(33)26(27)19-39-15-13-38(14-16-39)18-21-5-10-29-24(17-21)25(20-40(29)12-2-11-37-30(41)42)22-6-8-23(9-7-22)43-31(34,35)36/h1,3-10,17,20,37H,2,11-16,18-19H2,(H,41,42) |
| InChIKey | RKAQPAFMYCJRFY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|