C7H10N4O5 — CID 118541131
3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanamide (PubChem CID 118541131) has the molecular formula C7H10N4O5 and a molecular weight of 230.18 g/mol. Its IUPAC name is 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanamide.
| Compound Name | 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanamide |
|---|---|
| PubChem CID | 118541131 |
| Molecular Formula | C7H10N4O5 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propanamide |
| SMILES | NC(=O)CCC1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C7H10N4O5/c8-3(12)1-2-7(11-16)4(13)9-6(15)10-5(7)14/h11,16H,1-2H2,(H2,8,12)(H2,9,10,13,14,15) |
| InChIKey | BSOKNJUOSUYJMH-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|