C7H11N3O4 — CID 118541137
5-(hydroxyamino)-5-propan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 118541137) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is 5-(hydroxyamino)-5-propan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(hydroxyamino)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118541137 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 5-(hydroxyamino)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C7H11N3O4/c1-3(2)7(10-14)4(11)8-6(13)9-5(7)12/h3,10,14H,1-2H3,(H2,8,9,11,12,13) |
| InChIKey | VDXDALXYPAWNLX-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|