C8H14N4O4 — CID 118541154
5-(4-aminobutyl)-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione (PubChem CID 118541154) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-(4-aminobutyl)-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(4-aminobutyl)-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118541154 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 5-(4-aminobutyl)-5-(hydroxyamino)-1,3-diazinane-2,4,6-trione |
| SMILES | NCCCCC1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H14N4O4/c9-4-2-1-3-8(12-16)5(13)10-7(15)11-6(8)14/h12,16H,1-4,9H2,(H2,10,11,13,14,15) |
| InChIKey | NAXOIEUPPKXCSF-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|