C8H14N6O4 — CID 118541159
2-[3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]guanidine (PubChem CID 118541159) has the molecular formula C8H14N6O4 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-[3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]guanidine.
| Compound Name | 2-[3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]guanidine |
|---|---|
| PubChem CID | 118541159 |
| Molecular Formula | C8H14N6O4 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-[3-[5-(hydroxyamino)-2,4,6-trioxo-1,3-diazinan-5-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCC1(NO)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H14N6O4/c9-6(10)11-3-1-2-8(14-18)4(15)12-7(17)13-5(8)16/h14,18H,1-3H2,(H4,9,10,11)(H2,12,13,15,16,17) |
| InChIKey | KTUJIQZYYMSOBI-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|