C16H27N3O5S2 — CID 118541883
N-[5-(methanesulfonamido)-1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methanesulfonamide (PubChem CID 118541883) has the molecular formula C16H27N3O5S2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[5-(methanesulfonamido)-1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[5-(methanesulfonamido)-1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 118541883 |
| Molecular Formula | C16H27N3O5S2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[5-(methanesulfonamido)-1-[2-(3-methoxyphenyl)ethyl]piperidin-3-yl]methanesulfonamide |
| SMILES | COc1cccc(CCN2CC(NS(C)(=O)=O)CC(NS(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C16H27N3O5S2/c1-24-16-6-4-5-13(9-16)7-8-19-11-14(17-25(2,20)21)10-15(12-19)18-26(3,22)23/h4-6,9,14-15,17-18H,7-8,10-12H2,1-3H3 |
| InChIKey | YEDVFSOWYMFIFQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |