About 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine
2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine (PubChem CID 118541925) has the molecular formula C14H17N3O3S2
and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine |
| PubChem CID | 118541925 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine |
| SMILES | COc1ccccc1N1C(c2cccs2)NCN1S(C)(=O)=O |
| InChI | InChI=1S/C14H17N3O3S2/c1-20-12-7-4-3-6-11(12)17-14(13-8-5-9-21-13)15-10-16(17)22(2,18)19/h3-9,14-15H,10H2,1-2H3 |
| InChIKey | MZCNOFPMHNWOAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine?
The IUPAC name of 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine (CID 118541925) is 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine.
What is the SMILES notation for 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine?
The canonical SMILES for 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine is COc1ccccc1N1C(c2cccs2)NCN1S(C)(=O)=O.
What is the InChIKey of 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine?
The InChIKey is MZCNOFPMHNWOAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S2/c1-20-12-7-4-3-6-11(12)17-14(13-8-5-9-21-13)15-10-16(17)22(2,18)19/h3-9,14-15H,10H2,1-2H3.
What are the key properties of 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine?
2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine has a molecular weight of 339.44 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-1-methylsulfonyl-3-thiophen-2-yl-1,2,4-triazolidine is sourced from PubChem (CID 118541925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).