C26H32N4O2S2 — CID 118541980
2,4-dimethyl-5-(3-methyl-4-methylsulfanylphenyl)-1H-pyrazol-3-one (PubChem CID 118541980) has the molecular formula C26H32N4O2S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is 2,4-dimethyl-5-(3-methyl-4-methylsulfanylphenyl)-1H-pyrazol-3-one.
| Compound Name | 2,4-dimethyl-5-(3-methyl-4-methylsulfanylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 118541980 |
| Molecular Formula | C26H32N4O2S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2,4-dimethyl-5-(3-methyl-4-methylsulfanylphenyl)-1H-pyrazol-3-one |
| SMILES | CSc1ccc(-c2[nH]n(C)c(=O)c2C)cc1C.CSc1ccc(-c2[nH]n(C)c(=O)c2C)cc1C |
| InChI | InChI=1S/2C13H16N2OS/c2*1-8-7-10(5-6-11(8)17-4)12-9(2)13(16)15(3)14-12/h2*5-7,14H,1-4H3 |
| InChIKey | OABKAHITEXJJRO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 75.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |