About 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one
4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one (PubChem CID 118542012) has the molecular formula C24H28N4O4
and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one |
| PubChem CID | 118542012 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one |
| SMILES | COc1cccc(-c2c(C)[nH]n(C)c2=O)c1.COc1cccc(-c2c(C)[nH]n(C)c2=O)c1 |
| InChI | InChI=1S/2C12H14N2O2/c2*1-8-11(12(15)14(2)13-8)9-5-4-6-10(7-9)16-3/h2*4-7,13H,1-3H3 |
| InChIKey | WNAPWUVNYNKJRC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one?
The IUPAC name of 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one (CID 118542012) is 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one.
What is the SMILES notation for 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one?
The canonical SMILES for 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one is COc1cccc(-c2c(C)[nH]n(C)c2=O)c1.COc1cccc(-c2c(C)[nH]n(C)c2=O)c1.
What is the InChIKey of 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one?
The InChIKey is WNAPWUVNYNKJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H14N2O2/c2*1-8-11(12(15)14(2)13-8)9-5-4-6-10(7-9)16-3/h2*4-7,13H,1-3H3.
What are the key properties of 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one?
4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one has a molecular weight of 436.51 g/mol, XLogP of 3.39, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxyphenyl)-2,5-dimethyl-1H-pyrazol-3-one is sourced from PubChem (CID 118542012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).