C28H27N5O — CID 118542065
2-[4-[3-[4-cyano-N-[(3-methylimidazol-4-yl)methyl]anilino]propyl]phenyl]benzamide (PubChem CID 118542065) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 2-[4-[3-[4-cyano-N-[(3-methylimidazol-4-yl)methyl]anilino]propyl]phenyl]benzamide.
| Compound Name | 2-[4-[3-[4-cyano-N-[(3-methylimidazol-4-yl)methyl]anilino]propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 118542065 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[4-[3-[4-cyano-N-[(3-methylimidazol-4-yl)methyl]anilino]propyl]phenyl]benzamide |
| SMILES | Cn1cncc1CN(CCCc1ccc(-c2ccccc2C(N)=O)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H27N5O/c1-32-20-31-18-25(32)19-33(24-14-10-22(17-29)11-15-24)16-4-5-21-8-12-23(13-9-21)26-6-2-3-7-27(26)28(30)34/h2-3,6-15,18,20H,4-5,16,19H2,1H3,(H2,30,34) |
| InChIKey | KYVXEMDWIVEDJU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |