C28H28FN5O2 — CID 118543240
12-[(4-fluoropiperidin-1-yl)methyl]-4-(1H-inden-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118543240) has the molecular formula C28H28FN5O2 and a molecular weight of 485.56 g/mol. Its IUPAC name is 12-[(4-fluoropiperidin-1-yl)methyl]-4-(1H-inden-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 12-[(4-fluoropiperidin-1-yl)methyl]-4-(1H-inden-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118543240 |
| Molecular Formula | C28H28FN5O2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 12-[(4-fluoropiperidin-1-yl)methyl]-4-(1H-inden-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | FC1CCN(Cc2cnc3oc4c(N5CCOCC5)nc(-c5cccc6c5C=CC6)nc4c3c2)CC1 |
| InChI | InChI=1S/C28H28FN5O2/c29-20-7-9-33(10-8-20)17-18-15-23-24-25(36-28(23)30-16-18)27(34-11-13-35-14-12-34)32-26(31-24)22-6-2-4-19-3-1-5-21(19)22/h1-2,4-6,15-16,20H,3,7-14,17H2 |
| InChIKey | BQRGKUSBUAZDGV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |