C16H11ClF6N2O — CID 11854333
6-chloro-4-(2-cyclopropylethynyl)-3-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)-1H-quinazolin-2-one (PubChem CID 11854333) has the molecular formula C16H11ClF6N2O and a molecular weight of 396.72 g/mol. Its IUPAC name is 6-chloro-4-(2-cyclopropylethynyl)-3-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)-1H-quinazolin-2-one.
| Compound Name | 6-chloro-4-(2-cyclopropylethynyl)-3-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)-1H-quinazolin-2-one |
|---|---|
| PubChem CID | 11854333 |
| Molecular Formula | C16H11ClF6N2O |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6-chloro-4-(2-cyclopropylethynyl)-3-(2,2,2-trifluoroethyl)-4-(trifluoromethyl)-1H-quinazolin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C(C#CC2CC2)(C(F)(F)F)N1CC(F)(F)F |
| InChI | InChI=1S/C16H11ClF6N2O/c17-10-3-4-12-11(7-10)14(16(21,22)23,6-5-9-1-2-9)25(13(26)24-12)8-15(18,19)20/h3-4,7,9H,1-2,8H2,(H,24,26) |
| InChIKey | FAQBNLBHDUWRRV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|