C27H32N4O — CID 11854364
(4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone (PubChem CID 11854364) has the molecular formula C27H32N4O and a molecular weight of 428.58 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
|---|---|
| PubChem CID | 11854364 |
| Molecular Formula | C27H32N4O |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[5-prop-2-enyl-2-(pyridin-2-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-8-yl]methanone |
| SMILES | C=CCn1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(Cc1ccccn1)CC2 |
| InChI | InChI=1S/C27H32N4O/c1-3-13-31-25-8-7-21(27(32)30-15-9-20(2)10-16-30)17-23(25)24-19-29(14-11-26(24)31)18-22-6-4-5-12-28-22/h3-8,12,17,20H,1,9-11,13-16,18-19H2,2H3 |
| InChIKey | RHDKCARPLCNXCC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|