C9H13FN2 — CID 118543999
[(2E,4E)-4-(fluoromethyl)hepta-2,4,6-trien-3-yl]-methyldiazene (PubChem CID 118543999) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is [(2E,4E)-4-(fluoromethyl)hepta-2,4,6-trien-3-yl]-methyldiazene.
| Compound Name | [(2E,4E)-4-(fluoromethyl)hepta-2,4,6-trien-3-yl]-methyldiazene |
|---|---|
| PubChem CID | 118543999 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | [(2E,4E)-4-(fluoromethyl)hepta-2,4,6-trien-3-yl]-methyldiazene |
| SMILES | C=C/C=C(CF)\C(=C/C)\N=N\C |
| InChI | InChI=1S/C9H13FN2/c1-4-6-8(7-10)9(5-2)12-11-3/h4-6H,1,7H2,2-3H3/b8-6-,9-5+,12-11+ |
| InChIKey | OAHWYHRSUFZLES-HQJVNFKMSA-N |
| XLogP | 3.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|