C27H23F2NO5 — CID 11854420
5-[4-(2,3-difluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid (PubChem CID 11854420) has the molecular formula C27H23F2NO5 and a molecular weight of 479.48 g/mol. Its IUPAC name is 5-[4-(2,3-difluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid.
| Compound Name | 5-[4-(2,3-difluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 11854420 |
| Molecular Formula | C27H23F2NO5 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 5-[4-(2,3-difluorophenyl)phenyl]-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-hydroxypentanoic acid |
| SMILES | O=C(O)C(CCN1C(=O)c2ccccc2C1=O)C(O)CCc1ccc(-c2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C27H23F2NO5/c28-22-7-3-6-18(24(22)29)17-11-8-16(9-12-17)10-13-23(31)21(27(34)35)14-15-30-25(32)19-4-1-2-5-20(19)26(30)33/h1-9,11-12,21,23,31H,10,13-15H2,(H,34,35) |
| InChIKey | OPYCPRNICLUVQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|