About N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide
N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide (PubChem CID 118544259) has the molecular formula C13H19ClN2O2
and a molecular weight of 270.76 g/mol. Its IUPAC name is N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide |
| PubChem CID | 118544259 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(=O)c(CNC(=O)C(C)(C)C)c(Cl)n1C |
| InChI | InChI=1S/C13H19ClN2O2/c1-8-6-10(17)9(11(14)16(8)5)7-15-12(18)13(2,3)4/h6H,7H2,1-5H3,(H,15,18) |
| InChIKey | XSDLBGIKOOPJHL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide (CID 118544259) is N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide is Cc1cc(=O)c(CNC(=O)C(C)(C)C)c(Cl)n1C.
What is the InChIKey of N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide?
The InChIKey is XSDLBGIKOOPJHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O2/c1-8-6-10(17)9(11(14)16(8)5)7-15-12(18)13(2,3)4/h6H,7H2,1-5H3,(H,15,18).
What are the key properties of N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide?
N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide has a molecular weight of 270.76 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-1,6-dimethyl-4-oxo-3-pyridinyl)methyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 118544259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).