C22H26N4O2 — CID 11854433
2-(cyclopent-3-en-1-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (PubChem CID 11854433) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(cyclopent-3-en-1-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide.
| Compound Name | 2-(cyclopent-3-en-1-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
|---|---|
| PubChem CID | 11854433 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-(cyclopent-3-en-1-ylamino)-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| SMILES | Cc1nn(-c2ccc(C(N)=O)c(NC3CC=CC3)c2)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C22H26N4O2/c1-13-20-18(11-22(2,3)12-19(20)27)26(25-13)15-8-9-16(21(23)28)17(10-15)24-14-6-4-5-7-14/h4-5,8-10,14,24H,6-7,11-12H2,1-3H3,(H2,23,28) |
| InChIKey | ORECSGYHBYSKEA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|