About 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine
1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine (PubChem CID 118544356) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine.
Molecular Properties
| Compound Name | 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine |
| PubChem CID | 118544356 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine |
| SMILES | [H]/N=C/C(=N\C=C/C)N1CCC(C)CC1 |
| InChI | InChI=1S/C11H19N3/c1-3-6-13-11(9-12)14-7-4-10(2)5-8-14/h3,6,9-10,12H,4-5,7-8H2,1-2H3/b6-3-,12-9+,13-11+ |
| InChIKey | OPSDYICDIUPADX-VLNHDMJHSA-N |
| XLogP | 2.30 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine?
The IUPAC name of 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine (CID 118544356) is 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine.
What is the SMILES notation for 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine?
The canonical SMILES for 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine is [H]/N=C/C(=N\C=C/C)N1CCC(C)CC1.
What is the InChIKey of 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine?
The InChIKey is OPSDYICDIUPADX-VLNHDMJHSA-N. The full InChI is InChI=1S/C11H19N3/c1-3-6-13-11(9-12)14-7-4-10(2)5-8-14/h3,6,9-10,12H,4-5,7-8H2,1-2H3/b6-3-,12-9+,13-11+.
What are the key properties of 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine?
1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine has a molecular weight of 193.29 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpiperidin-1-yl)-N-[(Z)-prop-1-enyl]ethane-1,2-diimine is sourced from PubChem (CID 118544356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).