About (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde
(3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde (PubChem CID 118544649) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde.
Molecular Properties
| Compound Name | (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde |
| PubChem CID | 118544649 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde |
| SMILES | CC(C)c1cc([C@H]2C(C=O)N2c2ccc(C=O)cc2)c(O)cc1O |
| InChI | InChI=1S/C19H19NO4/c1-11(2)14-7-15(18(24)8-17(14)23)19-16(10-22)20(19)13-5-3-12(9-21)4-6-13/h3-11,16,19,23-24H,1-2H3/t16?,19-,20?/m0/s1 |
| InChIKey | VMURFVVSYFJLSY-AJPWXKBRSA-N |
| XLogP | 3.16 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde?
The IUPAC name of (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde (CID 118544649) is (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde.
What is the SMILES notation for (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde?
The canonical SMILES for (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde is CC(C)c1cc([C@H]2C(C=O)N2c2ccc(C=O)cc2)c(O)cc1O.
What is the InChIKey of (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde?
The InChIKey is VMURFVVSYFJLSY-AJPWXKBRSA-N. The full InChI is InChI=1S/C19H19NO4/c1-11(2)14-7-15(18(24)8-17(14)23)19-16(10-22)20(19)13-5-3-12(9-21)4-6-13/h3-11,16,19,23-24H,1-2H3/t16?,19-,20?/m0/s1.
What are the key properties of (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde?
(3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde has a molecular weight of 325.36 g/mol, XLogP of 3.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-1-(4-formylphenyl)aziridine-2-carbaldehyde is sourced from PubChem (CID 118544649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).