C17H33NO — CID 118545273
N-[(1-ethylcyclohexyl)methyl]-2-propylpentanamide (PubChem CID 118545273) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is N-[(1-ethylcyclohexyl)methyl]-2-propylpentanamide.
| Compound Name | N-[(1-ethylcyclohexyl)methyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 118545273 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | N-[(1-ethylcyclohexyl)methyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)NCC1(CC)CCCCC1 |
| InChI | InChI=1S/C17H33NO/c1-4-10-15(11-5-2)16(19)18-14-17(6-3)12-8-7-9-13-17/h15H,4-14H2,1-3H3,(H,18,19) |
| InChIKey | NOKATNXPOCNSBT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |