C21H35BrO2 — CID 118545544
tert-butyl (5R)-5-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoate (PubChem CID 118545544) has the molecular formula C21H35BrO2 and a molecular weight of 399.41 g/mol. Its IUPAC name is tert-butyl (5R)-5-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoate.
| Compound Name | tert-butyl (5R)-5-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoate |
|---|---|
| PubChem CID | 118545544 |
| Molecular Formula | C21H35BrO2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl (5R)-5-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoate |
| SMILES | C[C@H](CCCC(=O)OC(C)(C)C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C21H35BrO2/c1-15(8-6-10-19(23)24-20(2,3)4)17-11-12-18-16(14-22)9-7-13-21(17,18)5/h14-15,17-18H,6-13H2,1-5H3/b16-14+/t15-,17-,18+,21-/m1/s1 |
| InChIKey | ARIUPQLQDBQRLH-ZRVGIMEVSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |