C18H24Cl6N2O4 — CID 118546179
2,2-dimethyl-N-[(2R)-5,5,5-trichloro-1-[(2S)-3-methoxy-5-oxo-2-(3,3,3-trichloropropyl)-2H-pyrrol-1-yl]-1-oxopentan-2-yl]propanamide (PubChem CID 118546179) has the molecular formula C18H24Cl6N2O4 and a molecular weight of 545.12 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2R)-5,5,5-trichloro-1-[(2S)-3-methoxy-5-oxo-2-(3,3,3-trichloropropyl)-2H-pyrrol-1-yl]-1-oxopentan-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2R)-5,5,5-trichloro-1-[(2S)-3-methoxy-5-oxo-2-(3,3,3-trichloropropyl)-2H-pyrrol-1-yl]-1-oxopentan-2-yl]propanamide |
|---|---|
| PubChem CID | 118546179 |
| Molecular Formula | C18H24Cl6N2O4 |
| Molecular Weight | 545.12 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 2,2-dimethyl-N-[(2R)-5,5,5-trichloro-1-[(2S)-3-methoxy-5-oxo-2-(3,3,3-trichloropropyl)-2H-pyrrol-1-yl]-1-oxopentan-2-yl]propanamide |
| SMILES | COC1=CC(=O)N(C(=O)[C@@H](CCC(Cl)(Cl)Cl)NC(=O)C(C)(C)C)[C@H]1CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H24Cl6N2O4/c1-16(2,3)15(29)25-10(5-7-17(19,20)21)14(28)26-11(6-8-18(22,23)24)12(30-4)9-13(26)27/h9-11H,5-8H2,1-4H3,(H,25,29)/t10-,11+/m1/s1 |
| InChIKey | WCKVHTWCIZSNPP-MNOVXSKESA-N |
| XLogP | 5.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|