C18H31NO14 — CID 118546362
methyl (2R,4R,5R)-5-acetamido-4-hydroxy-2-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 118546362) has the molecular formula C18H31NO14 and a molecular weight of 485.44 g/mol. Its IUPAC name is methyl (2R,4R,5R)-5-acetamido-4-hydroxy-2-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-5-acetamido-4-hydroxy-2-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 118546362 |
| Molecular Formula | C18H31NO14 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | methyl (2R,4R,5R)-5-acetamido-4-hydroxy-2-[[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OCC2O[C@H](O)C(O)[C@@H](O)[C@@H]2O)C[C@@H](O)[C@@H](NC(C)=O)C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C18H31NO14/c1-6(21)19-10-7(22)3-18(17(29)30-2,33-15(10)11(24)8(23)4-20)31-5-9-12(25)13(26)14(27)16(28)32-9/h7-16,20,22-28H,3-5H2,1-2H3,(H,19,21)/t7-,8-,9?,10-,11-,12-,13+,14?,15?,16+,18-/m1/s1 |
| InChIKey | JKDRPSPXNOIFRZ-XZTUAVKRSA-N |
| XLogP | -5.96 |
| TPSA | 244.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |