C13H20O8 — CID 118546381
methyl (3S,5S,6R)-5-acetyloxy-6-ethoxy-4-formyl-3-methoxyoxane-2-carboxylate (PubChem CID 118546381) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is methyl (3S,5S,6R)-5-acetyloxy-6-ethoxy-4-formyl-3-methoxyoxane-2-carboxylate.
| Compound Name | methyl (3S,5S,6R)-5-acetyloxy-6-ethoxy-4-formyl-3-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 118546381 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl (3S,5S,6R)-5-acetyloxy-6-ethoxy-4-formyl-3-methoxyoxane-2-carboxylate |
| SMILES | CCO[C@@H]1OC(C(=O)OC)[C@@H](OC)C(C=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O8/c1-5-19-13-10(20-7(2)15)8(6-14)9(17-3)11(21-13)12(16)18-4/h6,8-11,13H,5H2,1-4H3/t8?,9-,10-,11?,13+/m0/s1 |
| InChIKey | FXMWYHNPOXUCDT-XKPMGNOJSA-N |
| XLogP | -0.32 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|