C49H29N5 — CID 118546442
4-[22-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-18-yl]benzonitrile (PubChem CID 118546442) has the molecular formula C49H29N5 and a molecular weight of 687.81 g/mol. Its IUPAC name is 4-[22-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-18-yl]benzonitrile.
| Compound Name | 4-[22-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-18-yl]benzonitrile |
|---|---|
| PubChem CID | 118546442 |
| Molecular Formula | C49H29N5 |
| Molecular Weight | 687.81 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | 4-[22-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaen-18-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)nc(-c2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c2)c2c4ccccc4c4ccccc4c32)cc1 |
| InChI | InChI=1S/C49H29N5/c50-30-31-22-24-32(25-23-31)35-26-27-42-43(29-35)51-46(45-41-21-10-8-19-39(41)38-18-7-9-20-40(38)44(42)45)36-16-11-17-37(28-36)49-53-47(33-12-3-1-4-13-33)52-48(54-49)34-14-5-2-6-15-34/h1-29H |
| InChIKey | NSUDMGXLRYSXAR-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.81 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|