C19H12ClN5 — CID 118546660
21-chloro-8,9,10,22,23-pentazapentacyclo[17.3.1.18,11.02,7.012,17]tetracosa-1(23),2,4,6,9,11(24),12,14,16,19,21-undecaene (PubChem CID 118546660) has the molecular formula C19H12ClN5 and a molecular weight of 345.79 g/mol. Its IUPAC name is 21-chloro-8,9,10,22,23-pentazapentacyclo[17.3.1.18,11.02,7.012,17]tetracosa-1(23),2,4,6,9,11(24),12,14,16,19,21-undecaene.
| Compound Name | 21-chloro-8,9,10,22,23-pentazapentacyclo[17.3.1.18,11.02,7.012,17]tetracosa-1(23),2,4,6,9,11(24),12,14,16,19,21-undecaene |
|---|---|
| PubChem CID | 118546660 |
| Molecular Formula | C19H12ClN5 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 21-chloro-8,9,10,22,23-pentazapentacyclo[17.3.1.18,11.02,7.012,17]tetracosa-1(23),2,4,6,9,11(24),12,14,16,19,21-undecaene |
| SMILES | Clc1cc2nc(n1)-c1ccccc1-n1cc(nn1)-c1ccccc1C2 |
| InChI | InChI=1S/C19H12ClN5/c20-18-10-13-9-12-5-1-2-6-14(12)16-11-25(24-23-16)17-8-4-3-7-15(17)19(21-13)22-18/h1-8,10-11H,9H2 |
| InChIKey | PLPFUIYAAQMGFK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |