About 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol
1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol (PubChem CID 118546764) has the molecular formula C10H18F4O5
and a molecular weight of 294.24 g/mol. Its IUPAC name is 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol.
Molecular Properties
| Compound Name | 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol |
| PubChem CID | 118546764 |
| Molecular Formula | C10H18F4O5 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol |
| SMILES | OCC(F)(F)COCCC(O)COCC(F)(F)CO |
| InChI | InChI=1S/C10H18F4O5/c11-9(12,4-15)6-18-2-1-8(17)3-19-7-10(13,14)5-16/h8,15-17H,1-7H2 |
| InChIKey | OMKYNLINTTWYCB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol?
The IUPAC name of 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol (CID 118546764) is 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol.
What is the SMILES notation for 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol?
The canonical SMILES for 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol is OCC(F)(F)COCCC(O)COCC(F)(F)CO.
What is the InChIKey of 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol?
The InChIKey is OMKYNLINTTWYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F4O5/c11-9(12,4-15)6-18-2-1-8(17)3-19-7-10(13,14)5-16/h8,15-17H,1-7H2.
What are the key properties of 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol?
1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol has a molecular weight of 294.24 g/mol, XLogP of 0.03, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(2,2-difluoro-3-hydroxypropoxy)butan-2-ol is sourced from PubChem (CID 118546764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).