C21H39NO7 — CID 118547478
(2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-hydroxybutyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide (PubChem CID 118547478) has the molecular formula C21H39NO7 and a molecular weight of 417.54 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-hydroxybutyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide.
| Compound Name | (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-hydroxybutyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide |
|---|---|
| PubChem CID | 118547478 |
| Molecular Formula | C21H39NO7 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (2S,3S)-2-hydroxy-N-[(S)-[(2S,4R,6R)-4-hydroxy-6-[(2R)-2-hydroxybutyl]-5,5-dimethyloxan-2-yl]-methoxymethyl]-3-methoxy-5-methylhex-5-enamide |
| SMILES | C=C(C)C[C@H](OC)[C@H](O)C(=O)N[C@@H](OC)[C@@H]1C[C@@H](O)C(C)(C)[C@@H](C[C@H](O)CC)O1 |
| InChI | InChI=1S/C21H39NO7/c1-8-13(23)10-17-21(4,5)16(24)11-15(29-17)20(28-7)22-19(26)18(25)14(27-6)9-12(2)3/h13-18,20,23-25H,2,8-11H2,1,3-7H3,(H,22,26)/t13-,14+,15+,16-,17-,18+,20+/m1/s1 |
| InChIKey | LLDLXIDYXCPVTK-LOYNAMIBSA-N |
| XLogP | 1.12 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|