About 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one
3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one (PubChem CID 118547552) has the molecular formula C25H26NO2P
and a molecular weight of 403.46 g/mol. Its IUPAC name is 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 118547552 |
| Molecular Formula | C25H26NO2P |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CCN1CC(CC=P(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O |
| InChI | InChI=1S/C25H26NO2P/c1-2-26-20-21(28-25(26)27)18-19-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,19,21H,2,18,20H2,1H3 |
| InChIKey | KDSUQNAJYWFLLQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one (CID 118547552) is 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one is CCN1CC(CC=P(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O.
What is the InChIKey of 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The InChIKey is KDSUQNAJYWFLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26NO2P/c1-2-26-20-21(28-25(26)27)18-19-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17,19,21H,2,18,20H2,1H3.
What are the key properties of 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one has a molecular weight of 403.46 g/mol, XLogP of 4.01, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 118547552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).