About tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate
tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate (PubChem CID 118547638) has the molecular formula C17H30O6
and a molecular weight of 330.42 g/mol. Its IUPAC name is tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate |
| PubChem CID | 118547638 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC1/C=C\C(OC(C)(C)C)CC(O)C(O)C1 |
| InChI | InChI=1S/C17H30O6/c1-16(2,3)22-12-8-7-11(9-13(18)14(19)10-12)21-15(20)23-17(4,5)6/h7-8,11-14,18-19H,9-10H2,1-6H3/b8-7- |
| InChIKey | ALLGOKACSFSLKT-FPLPWBNLSA-N |
| XLogP | 2.56 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate?
The IUPAC name of tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate (CID 118547638) is tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate.
What is the SMILES notation for tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate?
The canonical SMILES for tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate is CC(C)(C)OC(=O)OC1/C=C\C(OC(C)(C)C)CC(O)C(O)C1.
What is the InChIKey of tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate?
The InChIKey is ALLGOKACSFSLKT-FPLPWBNLSA-N. The full InChI is InChI=1S/C17H30O6/c1-16(2,3)22-12-8-7-11(9-13(18)14(19)10-12)21-15(20)23-17(4,5)6/h7-8,11-14,18-19H,9-10H2,1-6H3/b8-7-.
What are the key properties of tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate?
tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate has a molecular weight of 330.42 g/mol, XLogP of 2.56, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(2E)-6,7-dihydroxy-4-[(2-methylpropan-2-yl)oxy]cyclooct-2-en-1-yl] carbonate is sourced from PubChem (CID 118547638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).