C23H34O3 — CID 118547739
5,9-dimethyl-14-methylidene-15-prop-1-en-2-yloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 118547739) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 5,9-dimethyl-14-methylidene-15-prop-1-en-2-yloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | 5,9-dimethyl-14-methylidene-15-prop-1-en-2-yloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 118547739 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 5,9-dimethyl-14-methylidene-15-prop-1-en-2-yloxytetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C(C)OC1C(=C)C2CCC3C4(C)CCCC(C)(C(=O)O)C4CCC13C2 |
| InChI | InChI=1S/C23H34O3/c1-14(2)26-19-15(3)16-7-8-18-21(4)10-6-11-22(5,20(24)25)17(21)9-12-23(18,19)13-16/h16-19H,1,3,6-13H2,2,4-5H3,(H,24,25) |
| InChIKey | XJNVFLWIIIVMRU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|