C34H42N6O2 — CID 118548103
trans-(1S,2S)-1-N,2-N-bis(8-methoxy-4-pyrrolidin-1-ylquinolin-2-yl)cyclohexane-1,2-diamine (PubChem CID 118548103) has the molecular formula C34H42N6O2 and a molecular weight of 566.75 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis(8-methoxy-4-pyrrolidin-1-ylquinolin-2-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis(8-methoxy-4-pyrrolidin-1-ylquinolin-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 118548103 |
| Molecular Formula | C34H42N6O2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis(8-methoxy-4-pyrrolidin-1-ylquinolin-2-yl)cyclohexane-1,2-diamine |
| SMILES | COc1cccc2c(N3CCCC3)cc(N[C@H]3CCCC[C@@H]3Nc3cc(N4CCCC4)c4cccc(OC)c4n3)nc12 |
| InChI | InChI=1S/C34H42N6O2/c1-41-29-15-9-11-23-27(39-17-5-6-18-39)21-31(37-33(23)29)35-25-13-3-4-14-26(25)36-32-22-28(40-19-7-8-20-40)24-12-10-16-30(42-2)34(24)38-32/h9-12,15-16,21-22,25-26H,3-8,13-14,17-20H2,1-2H3,(H,35,37)(H,36,38)/t25-,26-/m0/s1 |
| InChIKey | HOPPLCYHKIRKRK-UIOOFZCWSA-N |
| XLogP | 6.84 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |