C24H27N3O5S — CID 11854817
cis-(1S,2R)-N-hydroxy-2-[methyl-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide (PubChem CID 11854817) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is cis-(1S,2R)-N-hydroxy-2-[methyl-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-hydroxy-2-[methyl-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 11854817 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | cis-(1S,2R)-N-hydroxy-2-[methyl-[4-[(2-methylquinolin-4-yl)methoxy]phenyl]sulfonylamino]cyclopentane-1-carboxamide |
| SMILES | Cc1cc(COc2ccc(S(=O)(=O)N(C)[C@@H]3CCC[C@@H]3C(=O)NO)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H27N3O5S/c1-16-14-17(20-6-3-4-8-22(20)25-16)15-32-18-10-12-19(13-11-18)33(30,31)27(2)23-9-5-7-21(23)24(28)26-29/h3-4,6,8,10-14,21,23,29H,5,7,9,15H2,1-2H3,(H,26,28)/t21-,23+/m0/s1 |
| InChIKey | YCPPWBXGHRHAGM-JTHBVZDNSA-N |
| XLogP | 3.42 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|