C9H13N3O4 — CID 118548378
5-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 118548378) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118548378 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-[(E)-N-methoxy-C-methylcarbonimidoyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CO/N=C(\C)C1C(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C9H13N3O4/c1-5(10-16-4)6-7(13)11(2)9(15)12(3)8(6)14/h6H,1-4H3/b10-5+ |
| InChIKey | MJXRNUDBYYJZPL-BJMVGYQFSA-N |
| XLogP | -0.32 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|