C35H65FO10 — CID 118548402
[(2S,3S,5S)-4,5-dibutoxy-2-[(3S,5S,6S)-4-butoxy-2-(butoxymethyl)-6-fluoro-5-methyloxan-3-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate (PubChem CID 118548402) has the molecular formula C35H65FO10 and a molecular weight of 664.89 g/mol. Its IUPAC name is [(2S,3S,5S)-4,5-dibutoxy-2-[(3S,5S,6S)-4-butoxy-2-(butoxymethyl)-6-fluoro-5-methyloxan-3-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2S,3S,5S)-4,5-dibutoxy-2-[(3S,5S,6S)-4-butoxy-2-(butoxymethyl)-6-fluoro-5-methyloxan-3-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 118548402 |
| Molecular Formula | C35H65FO10 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.46 |
| IUPAC Name | [(2S,3S,5S)-4,5-dibutoxy-2-[(3S,5S,6S)-4-butoxy-2-(butoxymethyl)-6-fluoro-5-methyloxan-3-yl]oxy-6-(butoxymethyl)oxan-3-yl] acetate |
| SMILES | CCCCOCC1O[C@@H](F)[C@@H](C)C(OCCCC)[C@@H]1O[C@@H]1OC(COCCCC)[C@H](OCCCC)C(OCCCC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C35H65FO10/c1-8-13-18-38-23-27-30(41-21-16-11-4)32(42-22-17-12-5)33(43-26(7)37)35(45-27)46-31-28(24-39-19-14-9-2)44-34(36)25(6)29(31)40-20-15-10-3/h25,27-35H,8-24H2,1-7H3/t25-,27?,28?,29?,30-,31+,32?,33-,34+,35-/m0/s1 |
| InChIKey | ZZHCNJOQFIKWME-BQHBPRBFSA-N |
| XLogP | 6.55 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|