C23H32N6O4 — CID 118548414
3-[2,4-dimethoxy-5-[[5-[[methyl-[3-(methylamino)propyl]amino]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenoxy]prop-1-en-2-ol (PubChem CID 118548414) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-[2,4-dimethoxy-5-[[5-[[methyl-[3-(methylamino)propyl]amino]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenoxy]prop-1-en-2-ol.
| Compound Name | 3-[2,4-dimethoxy-5-[[5-[[methyl-[3-(methylamino)propyl]amino]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenoxy]prop-1-en-2-ol |
|---|---|
| PubChem CID | 118548414 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-[2,4-dimethoxy-5-[[5-[[methyl-[3-(methylamino)propyl]amino]methyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenoxy]prop-1-en-2-ol |
| SMILES | C=C(O)COc1cc(Nc2ncnc3[nH]cc(CN(C)CCCNC)c23)c(OC)cc1OC |
| InChI | InChI=1S/C23H32N6O4/c1-15(30)13-33-20-9-17(18(31-4)10-19(20)32-5)28-23-21-16(11-25-22(21)26-14-27-23)12-29(3)8-6-7-24-2/h9-11,14,24,30H,1,6-8,12-13H2,2-5H3,(H2,25,26,27,28) |
| InChIKey | ZMHVXHOLSMLTEU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|