C11H18N2O — CID 118548891
4-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-1,2,3,4-tetrahydropyridin-6-ol (PubChem CID 118548891) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-1,2,3,4-tetrahydropyridin-6-ol.
| Compound Name | 4-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-1,2,3,4-tetrahydropyridin-6-ol |
|---|---|
| PubChem CID | 118548891 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-(5-methyl-1,2,3,6-tetrahydropyridin-3-yl)-1,2,3,4-tetrahydropyridin-6-ol |
| SMILES | CC1=CC(C2C=C(O)NCC2)CNC1 |
| InChI | InChI=1S/C11H18N2O/c1-8-4-10(7-12-6-8)9-2-3-13-11(14)5-9/h4-5,9-10,12-14H,2-3,6-7H2,1H3 |
| InChIKey | NKOZJJVGMUZKLE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|